C14H9Cl3N4O2S — CID 19580803
4-[(E)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 19580803) has the molecular formula C14H9Cl3N4O2S and a molecular weight of 403.68 g/mol. Its IUPAC name is 4-[(E)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 19580803 |
| Molecular Formula | C14H9Cl3N4O2S |
| Molecular Weight | 403.68 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 4-[(E)-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1/N=C/c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C14H9Cl3N4O2S/c15-8-3-11(16)13(12(17)4-8)22-6-10-2-1-9(23-10)5-19-21-7-18-20-14(21)24/h1-5,7H,6H2,(H,20,24)/b19-5+ |
| InChIKey | XWAIKWFIIJWCSR-PTXOJBNSSA-N |
| XLogP | 4.96 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|