C13H11F2N3O2S — CID 19580847
2-[4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl]sulfanylacetamide (PubChem CID 19580847) has the molecular formula C13H11F2N3O2S and a molecular weight of 311.31 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | 2-[4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 19580847 |
| Molecular Formula | C13H11F2N3O2S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl]sulfanylacetamide |
| SMILES | NC(=O)CSc1nccc(-c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C13H11F2N3O2S/c14-12(15)20-9-3-1-8(2-4-9)10-5-6-17-13(18-10)21-7-11(16)19/h1-6,12H,7H2,(H2,16,19) |
| InChIKey | FFUBOZQGEXBOTL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |