C13H14N2OS — CID 19580860
2-(2-methylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one (PubChem CID 19580860) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(2-methylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one.
| Compound Name | 2-(2-methylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 19580860 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-(2-methylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one |
| SMILES | Cc1ccccc1N1C(=O)C2CCCN2C1=S |
| InChI | InChI=1S/C13H14N2OS/c1-9-5-2-3-6-10(9)15-12(16)11-7-4-8-14(11)13(15)17/h2-3,5-6,11H,4,7-8H2,1H3 |
| InChIKey | GRGZNZGHFWOLDW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|