C19H18BrN5OS — CID 19581239
4-(2-bromophenyl)-N,N-diethyl-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide (PubChem CID 19581239) has the molecular formula C19H18BrN5OS and a molecular weight of 444.36 g/mol. Its IUPAC name is 4-(2-bromophenyl)-N,N-diethyl-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide.
| Compound Name | 4-(2-bromophenyl)-N,N-diethyl-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 19581239 |
| Molecular Formula | C19H18BrN5OS |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 4-(2-bromophenyl)-N,N-diethyl-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
| SMILES | CCN(CC)C(=O)c1sc2ncn3nc(-c4ccccc4Br)nc3c2c1C |
| InChI | InChI=1S/C19H18BrN5OS/c1-4-24(5-2)19(26)15-11(3)14-17-22-16(12-8-6-7-9-13(12)20)23-25(17)10-21-18(14)27-15/h6-10H,4-5H2,1-3H3 |
| InChIKey | SRZPWUWKKGIIQM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |