C23H23ClN4O2 — CID 19581353
2-amino-4-(2-chloro-4,5-diethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 19581353) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 2-amino-4-(2-chloro-4,5-diethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-4-(2-chloro-4,5-diethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 19581353 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-amino-4-(2-chloro-4,5-diethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | CCOc1cc(Cl)c(C2C3CCCC=C3C(C#N)=C(N)C2(C#N)C#N)cc1OCC |
| InChI | InChI=1S/C23H23ClN4O2/c1-3-29-19-9-16(18(24)10-20(19)30-4-2)21-15-8-6-5-7-14(15)17(11-25)22(28)23(21,12-26)13-27/h7,9-10,15,21H,3-6,8,28H2,1-2H3 |
| InChIKey | HKQFZJVTHHUXIR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|