C12H13ClFN3O2S — CID 19582324
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide (PubChem CID 19582324) has the molecular formula C12H13ClFN3O2S and a molecular weight of 317.77 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 19582324 |
| Molecular Formula | C12H13ClFN3O2S |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccn(Cc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C12H13ClFN3O2S/c1-2-20(18,19)16-12-5-6-17(15-12)8-9-3-4-10(14)7-11(9)13/h3-7H,2,8H2,1H3,(H,15,16) |
| InChIKey | MZULPQXUCHASDE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |