About 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine
1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine (PubChem CID 19582904) has the molecular formula C14H22N6O4S2
and a molecular weight of 402.50 g/mol. Its IUPAC name is 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine.
Molecular Properties
| Compound Name | 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine |
| PubChem CID | 19582904 |
| Molecular Formula | C14H22N6O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine |
| SMILES | Cc1c(S(=O)(=O)N2CCN(S(=O)(=O)c3cnn(C)c3C)CC2)cnn1C |
| InChI | InChI=1S/C14H22N6O4S2/c1-11-13(9-15-17(11)3)25(21,22)19-5-7-20(8-6-19)26(23,24)14-10-16-18(4)12(14)2/h9-10H,5-8H2,1-4H3 |
| InChIKey | KIXOSXYVAMBQAE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 110.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine?
The IUPAC name of 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine (CID 19582904) is 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine.
What is the SMILES notation for 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine?
The canonical SMILES for 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine is Cc1c(S(=O)(=O)N2CCN(S(=O)(=O)c3cnn(C)c3C)CC2)cnn1C.
What is the InChIKey of 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine?
The InChIKey is KIXOSXYVAMBQAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6O4S2/c1-11-13(9-15-17(11)3)25(21,22)19-5-7-20(8-6-19)26(23,24)14-10-16-18(4)12(14)2/h9-10H,5-8H2,1-4H3.
What are the key properties of 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine?
1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine has a molecular weight of 402.50 g/mol, XLogP of -0.53, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[(1,5-dimethylpyrazol-4-yl)sulfonyl]piperazine is sourced from PubChem (CID 19582904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).