C18H12N12O2 — CID 19582935
4-[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19582935) has the molecular formula C18H12N12O2 and a molecular weight of 428.38 g/mol. Its IUPAC name is 4-[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19582935 |
| Molecular Formula | C18H12N12O2 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | O=[N+]([O-])c1ncn(Cn2ccc(-c3nc4c5cnn(-c6ccccc6)c5ncn4n3)n2)n1 |
| InChI | InChI=1S/C18H12N12O2/c31-30(32)18-20-9-27(25-18)11-26-7-6-14(23-26)15-22-17-13-8-21-29(12-4-2-1-3-5-12)16(13)19-10-28(17)24-15/h1-10H,11H2 |
| InChIKey | BQGYCXJEKQHIRO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 152.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|