C20H22N4 — CID 19583070
2-(1-adamantylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 19583070) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(1-adamantylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 2-(1-adamantylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 19583070 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-(1-adamantylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | c1ccc2c(c1)ncn1nc(CC34CC5CC(CC(C5)C3)C4)nc21 |
| InChI | InChI=1S/C20H22N4/c1-2-4-17-16(3-1)19-22-18(23-24(19)12-21-17)11-20-8-13-5-14(9-20)7-15(6-13)10-20/h1-4,12-15H,5-11H2 |
| InChIKey | LXIQDDBVAZZIGG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |