About 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole (PubChem CID 19583686) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole |
| PubChem CID | 19583686 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole |
| SMILES | Cc1nn(C)cc1-c1ccno1 |
| InChI | InChI=1S/C8H9N3O/c1-6-7(5-11(2)10-6)8-3-4-9-12-8/h3-5H,1-2H3 |
| InChIKey | DKAUEBPKFGYXAT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole?
The IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole (CID 19583686) is 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole.
What is the SMILES notation for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole?
The canonical SMILES for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole is Cc1nn(C)cc1-c1ccno1.
What is the InChIKey of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole?
The InChIKey is DKAUEBPKFGYXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-6-7(5-11(2)10-6)8-3-4-9-12-8/h3-5H,1-2H3.
What are the key properties of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole?
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole has a molecular weight of 163.18 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole is sourced from PubChem (CID 19583686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).