About 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine
2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 19583785) has the molecular formula C24H13Br2F3N4O
and a molecular weight of 590.20 g/mol. Its IUPAC name is 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 19583785 |
| Molecular Formula | C24H13Br2F3N4O |
| Molecular Weight | 590.20 g/mol |
| Exact Mass | 587.94 |
| IUPAC Name | 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(-c2ccco2)nc(-n2nc(-c3cccc(Br)c3)cc2-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C24H13Br2F3N4O/c25-16-6-1-4-14(10-16)18-12-20(15-5-2-7-17(26)11-15)33(32-18)23-30-19(21-8-3-9-34-21)13-22(31-23)24(27,28)29/h1-13H |
| InChIKey | IWESMEIXONXGNE-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.20 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine (CID 19583785) is 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine is FC(F)(F)c1cc(-c2ccco2)nc(-n2nc(-c3cccc(Br)c3)cc2-c2cccc(Br)c2)n1.
What is the InChIKey of 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine?
The InChIKey is IWESMEIXONXGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H13Br2F3N4O/c25-16-6-1-4-14(10-16)18-12-20(15-5-2-7-17(26)11-15)33(32-18)23-30-19(21-8-3-9-34-21)13-22(31-23)24(27,28)29/h1-13H.
What are the key properties of 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine?
2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine has a molecular weight of 590.20 g/mol, XLogP of 7.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(3-bromophenyl)pyrazol-1-yl]-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 19583785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).