C20H20N4S — CID 19583878
12-ethyl-11-methyl-4-[2-(4-methylphenyl)cyclopropyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19583878) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 12-ethyl-11-methyl-4-[2-(4-methylphenyl)cyclopropyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 12-ethyl-11-methyl-4-[2-(4-methylphenyl)cyclopropyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19583878 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 12-ethyl-11-methyl-4-[2-(4-methylphenyl)cyclopropyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1c(C)sc2ncn3nc(C4CC4c4ccc(C)cc4)nc3c12 |
| InChI | InChI=1S/C20H20N4S/c1-4-14-12(3)25-20-17(14)19-22-18(23-24(19)10-21-20)16-9-15(16)13-7-5-11(2)6-8-13/h5-8,10,15-16H,4,9H2,1-3H3 |
| InChIKey | IXTIMDNXEMURGN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |