C15H24N2O2S — CID 19583934
1-[1-(4-ethoxyphenyl)ethyl]-3-(3-methoxypropyl)thiourea (PubChem CID 19583934) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-[1-(4-ethoxyphenyl)ethyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[1-(4-ethoxyphenyl)ethyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 19583934 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[1-(4-ethoxyphenyl)ethyl]-3-(3-methoxypropyl)thiourea |
| SMILES | CCOc1ccc(C(C)NC(=S)NCCCOC)cc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-4-19-14-8-6-13(7-9-14)12(2)17-15(20)16-10-5-11-18-3/h6-9,12H,4-5,10-11H2,1-3H3,(H2,16,17,20) |
| InChIKey | IMUPVRXLELUEHK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|