C16H17N7O2S — CID 19584088
12-ethyl-11-methyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19584088) has the molecular formula C16H17N7O2S and a molecular weight of 371.43 g/mol. Its IUPAC name is 12-ethyl-11-methyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 12-ethyl-11-methyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19584088 |
| Molecular Formula | C16H17N7O2S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 12-ethyl-11-methyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1c(C)sc2ncn3nc(CCn4nc([N+](=O)[O-])cc4C)nc3c12 |
| InChI | InChI=1S/C16H17N7O2S/c1-4-11-10(3)26-16-14(11)15-18-12(19-22(15)8-17-16)5-6-21-9(2)7-13(20-21)23(24)25/h7-8H,4-6H2,1-3H3 |
| InChIKey | FYNGSADFMYMMRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|