C17H14ClFN8O2S — CID 19585478
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 19585478) has the molecular formula C17H14ClFN8O2S and a molecular weight of 448.87 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 19585478 |
| Molecular Formula | C17H14ClFN8O2S |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1nnc(Nc2ccn(Cc3c(F)cccc3Cl)n2)s1 |
| InChI | InChI=1S/C17H14ClFN8O2S/c1-10-7-15(27(28)29)24-26(10)9-16-21-22-17(30-16)20-14-5-6-25(23-14)8-11-12(18)3-2-4-13(11)19/h2-7H,8-9H2,1H3,(H,20,22,23) |
| InChIKey | LHRPLDBYSLZDFB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|