About 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one
2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one (PubChem CID 19586113) has the molecular formula C18H13N3OS
and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one.
Molecular Properties
| Compound Name | 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one |
| PubChem CID | 19586113 |
| Molecular Formula | C18H13N3OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one |
| SMILES | Cc1sc(-n2ncc3ccccc3c2=O)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H13N3OS/c1-12-16(13-7-3-2-4-8-13)20-18(23-12)21-17(22)15-10-6-5-9-14(15)11-19-21/h2-11H,1H3 |
| InChIKey | QPOUIGYITKHNFF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one?
The IUPAC name of 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one (CID 19586113) is 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one.
What is the SMILES notation for 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one?
The canonical SMILES for 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one is Cc1sc(-n2ncc3ccccc3c2=O)nc1-c1ccccc1.
What is the InChIKey of 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one?
The InChIKey is QPOUIGYITKHNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3OS/c1-12-16(13-7-3-2-4-8-13)20-18(23-12)21-17(22)15-10-6-5-9-14(15)11-19-21/h2-11H,1H3.
What are the key properties of 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one?
2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one has a molecular weight of 319.39 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phthalazin-1-one is sourced from PubChem (CID 19586113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).