C25H24N2O3 — CID 19587078
3,5-bis(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrazole (PubChem CID 19587078) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3,5-bis(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrazole.
| Compound Name | 3,5-bis(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 19587078 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3,5-bis(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrazole |
| SMILES | COc1ccc(Cn2nc(-c3ccccc3OC)cc2-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-28-19-14-12-18(13-15-19)17-27-23(21-9-5-7-11-25(21)30-3)16-22(26-27)20-8-4-6-10-24(20)29-2/h4-16H,17H2,1-3H3 |
| InChIKey | JDGSQGPNJJLWDB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |