About 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole
1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole (PubChem CID 19587205) has the molecular formula C27H27ClN2
and a molecular weight of 414.98 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole.
Molecular Properties
| Compound Name | 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole |
| PubChem CID | 19587205 |
| Molecular Formula | C27H27ClN2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole |
| SMILES | Cc1ccc(-c2nn(Cc3ccc(Cl)cc3)c(-c3ccc(C)c(C)c3)c2C)cc1C |
| InChI | InChI=1S/C27H27ClN2/c1-17-6-10-23(14-19(17)3)26-21(5)27(24-11-7-18(2)20(4)15-24)30(29-26)16-22-8-12-25(28)13-9-22/h6-15H,16H2,1-5H3 |
| InChIKey | KKVARCOJAANCQR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole?
The IUPAC name of 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole (CID 19587205) is 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole.
What is the SMILES notation for 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole?
The canonical SMILES for 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole is Cc1ccc(-c2nn(Cc3ccc(Cl)cc3)c(-c3ccc(C)c(C)c3)c2C)cc1C.
What is the InChIKey of 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole?
The InChIKey is KKVARCOJAANCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27ClN2/c1-17-6-10-23(14-19(17)3)26-21(5)27(24-11-7-18(2)20(4)15-24)30(29-26)16-22-8-12-25(28)13-9-22/h6-15H,16H2,1-5H3.
What are the key properties of 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole?
1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole has a molecular weight of 414.98 g/mol, XLogP of 7.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-4-methylpyrazole is sourced from PubChem (CID 19587205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).