C15H10Br2N2 — CID 19587667
3,5-bis(3-bromophenyl)-1H-pyrazole (PubChem CID 19587667) has the molecular formula C15H10Br2N2 and a molecular weight of 378.07 g/mol. Its IUPAC name is 3,5-bis(3-bromophenyl)-1H-pyrazole.
| Compound Name | 3,5-bis(3-bromophenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 19587667 |
| Molecular Formula | C15H10Br2N2 |
| Molecular Weight | 378.07 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 3,5-bis(3-bromophenyl)-1H-pyrazole |
| SMILES | Brc1cccc(-c2cc(-c3cccc(Br)c3)[nH]n2)c1 |
| InChI | InChI=1S/C15H10Br2N2/c16-12-5-1-3-10(7-12)14-9-15(19-18-14)11-4-2-6-13(17)8-11/h1-9H,(H,18,19) |
| InChIKey | BWBSZXZJCUXJHR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.07 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |