About 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole
5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole (PubChem CID 19587891) has the molecular formula C10H12F2N4O2S
and a molecular weight of 290.30 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole |
| PubChem CID | 19587891 |
| Molecular Formula | C10H12F2N4O2S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole |
| SMILES | Cc1cc(C(F)F)n(S(=O)(=O)c2cn(C)nc2C)n1 |
| InChI | InChI=1S/C10H12F2N4O2S/c1-6-4-8(10(11)12)16(13-6)19(17,18)9-5-15(3)14-7(9)2/h4-5,10H,1-3H3 |
| InChIKey | DXQMKAWZGMXKBJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole?
The IUPAC name of 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole (CID 19587891) is 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole.
What is the SMILES notation for 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole?
The canonical SMILES for 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole is Cc1cc(C(F)F)n(S(=O)(=O)c2cn(C)nc2C)n1.
What is the InChIKey of 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole?
The InChIKey is DXQMKAWZGMXKBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N4O2S/c1-6-4-8(10(11)12)16(13-6)19(17,18)9-5-15(3)14-7(9)2/h4-5,10H,1-3H3.
What are the key properties of 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole?
5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole has a molecular weight of 290.30 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-methylpyrazole is sourced from PubChem (CID 19587891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).