About 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile
4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 19587898) has the molecular formula C28H19N5O
and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile |
| PubChem CID | 19587898 |
| Molecular Formula | C28H19N5O |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | Cc1cccc(-c2ccc(Oc3cc(C#N)c(C#N)cc3-n3nnc4ccccc43)c(C)c2)c1 |
| InChI | InChI=1S/C28H19N5O/c1-18-6-5-7-20(12-18)21-10-11-27(19(2)13-21)34-28-15-23(17-30)22(16-29)14-26(28)33-25-9-4-3-8-24(25)31-32-33/h3-15H,1-2H3 |
| InChIKey | LTMLSOYXOJWBPB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 87.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile?
The IUPAC name of 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile (CID 19587898) is 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile is Cc1cccc(-c2ccc(Oc3cc(C#N)c(C#N)cc3-n3nnc4ccccc43)c(C)c2)c1.
What is the InChIKey of 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile?
The InChIKey is LTMLSOYXOJWBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19N5O/c1-18-6-5-7-20(12-18)21-10-11-27(19(2)13-21)34-28-15-23(17-30)22(16-29)14-26(28)33-25-9-4-3-8-24(25)31-32-33/h3-15H,1-2H3.
What are the key properties of 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile?
4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile has a molecular weight of 441.49 g/mol, XLogP of 6.24, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzotriazol-1-yl)-5-[2-methyl-4-(3-methylphenyl)phenoxy]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 19587898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).