C29H19NO6 — CID 19588037
ethyl 4-(19,21-dioxo-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaen-20-yl)benzoate (PubChem CID 19588037) has the molecular formula C29H19NO6 and a molecular weight of 477.47 g/mol. Its IUPAC name is ethyl 4-(19,21-dioxo-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaen-20-yl)benzoate.
| Compound Name | ethyl 4-(19,21-dioxo-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaen-20-yl)benzoate |
|---|---|
| PubChem CID | 19588037 |
| Molecular Formula | C29H19NO6 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | ethyl 4-(19,21-dioxo-2,15-dioxa-20-azapentacyclo[14.7.0.03,8.09,14.018,22]tricosa-1(16),3,5,7,9,11,13,17,22-nonaen-20-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)c3cc4oc5ccccc5c5ccccc5oc4cc3C2=O)cc1 |
| InChI | InChI=1S/C29H19NO6/c1-2-34-29(33)17-11-13-18(14-12-17)30-27(31)21-15-25-26(16-22(21)28(30)32)36-24-10-6-4-8-20(24)19-7-3-5-9-23(19)35-25/h3-16H,2H2,1H3 |
| InChIKey | DGGJHRRQIDNHAS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|