C23H23F2N5O2 — CID 19588572
3,6-dicyclopropyl-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1-methylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 19588572) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 3,6-dicyclopropyl-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1-methylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 3,6-dicyclopropyl-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1-methylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 19588572 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3,6-dicyclopropyl-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1-methylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(C2CC2)nc2c1c(C1CC1)nn2C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C23H23F2N5O2/c1-12(15-4-3-5-16(10-15)32-23(24)25)27-28-22(31)17-11-18(13-6-7-13)26-21-19(17)20(14-8-9-14)29-30(21)2/h3-5,10-11,13-14,23H,6-9H2,1-2H3,(H,28,31)/b27-12+ |
| InChIKey | SASNKRJHYUHYKM-KKMKTNMSSA-N |
| XLogP | 4.48 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|