About 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine
1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine (PubChem CID 19589079) has the molecular formula C20H22F3N3
and a molecular weight of 361.41 g/mol. Its IUPAC name is 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine |
| PubChem CID | 19589079 |
| Molecular Formula | C20H22F3N3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine |
| SMILES | CCCCn1nc(C)c2c(C(F)(F)F)cc(-c3ccc(C)c(C)c3)nc21 |
| InChI | InChI=1S/C20H22F3N3/c1-5-6-9-26-19-18(14(4)25-26)16(20(21,22)23)11-17(24-19)15-8-7-12(2)13(3)10-15/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | WJXGXVSWFVUUFN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
The IUPAC name of 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine (CID 19589079) is 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
The canonical SMILES for 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine is CCCCn1nc(C)c2c(C(F)(F)F)cc(-c3ccc(C)c(C)c3)nc21.
What is the InChIKey of 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
The InChIKey is WJXGXVSWFVUUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3N3/c1-5-6-9-26-19-18(14(4)25-26)16(20(21,22)23)11-17(24-19)15-8-7-12(2)13(3)10-15/h7-8,10-11H,5-6,9H2,1-4H3.
What are the key properties of 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine has a molecular weight of 361.41 g/mol, XLogP of 5.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-6-(3,4-dimethylphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine is sourced from PubChem (CID 19589079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).