About 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine
1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine (PubChem CID 19589194) has the molecular formula C17H19F2N3S
and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine |
| PubChem CID | 19589194 |
| Molecular Formula | C17H19F2N3S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine |
| SMILES | CCCCn1nc(C)c2c(C(F)F)cc(-c3ccc(C)s3)nc21 |
| InChI | InChI=1S/C17H19F2N3S/c1-4-5-8-22-17-15(11(3)21-22)12(16(18)19)9-13(20-17)14-7-6-10(2)23-14/h6-7,9,16H,4-5,8H2,1-3H3 |
| InChIKey | XFOMOMNPTVJOGW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine?
The IUPAC name of 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine (CID 19589194) is 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine?
The canonical SMILES for 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine is CCCCn1nc(C)c2c(C(F)F)cc(-c3ccc(C)s3)nc21.
What is the InChIKey of 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine?
The InChIKey is XFOMOMNPTVJOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N3S/c1-4-5-8-22-17-15(11(3)21-22)12(16(18)19)9-13(20-17)14-7-6-10(2)23-14/h6-7,9,16H,4-5,8H2,1-3H3.
What are the key properties of 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine?
1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine has a molecular weight of 335.42 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-(difluoromethyl)-3-methyl-6-(5-methylthiophen-2-yl)pyrazolo[5,4-b]pyridine is sourced from PubChem (CID 19589194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).