C13H8N2OS — CID 19589402
5-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),3,8,10,12,14-hexaen-7-one (PubChem CID 19589402) has the molecular formula C13H8N2OS and a molecular weight of 240.29 g/mol. Its IUPAC name is 5-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),3,8,10,12,14-hexaen-7-one.
| Compound Name | 5-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),3,8,10,12,14-hexaen-7-one |
|---|---|
| PubChem CID | 19589402 |
| Molecular Formula | C13H8N2OS |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 5-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),3,8,10,12,14-hexaen-7-one |
| SMILES | O=c1nc2n(c3ccsc13)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H8N2OS/c16-13-11-10(5-6-17-11)15-7-8-3-1-2-4-9(8)12(15)14-13/h1-6H,7H2 |
| InChIKey | KCZISIDEXVCMPZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |