About 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione
2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione (PubChem CID 19589907) has the molecular formula C15H15N3O4
and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione |
| PubChem CID | 19589907 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N(c1cn(C)nc1C)C2=O |
| InChI | InChI=1S/C15H15N3O4/c1-8-10(7-17(2)16-8)18-14(19)9-5-6-11(21-3)13(22-4)12(9)15(18)20/h5-7H,1-4H3 |
| InChIKey | ZZYFHTHTIQUVIK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione?
The IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione (CID 19589907) is 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione.
What is the SMILES notation for 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione?
The canonical SMILES for 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione is COc1ccc2c(c1OC)C(=O)N(c1cn(C)nc1C)C2=O.
What is the InChIKey of 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione?
The InChIKey is ZZYFHTHTIQUVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4/c1-8-10(7-17(2)16-8)18-14(19)9-5-6-11(21-3)13(22-4)12(9)15(18)20/h5-7H,1-4H3.
What are the key properties of 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione?
2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione has a molecular weight of 301.30 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylpyrazol-4-yl)-4,5-dimethoxyisoindole-1,3-dione is sourced from PubChem (CID 19589907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).