C17H17BrF2N2O3 — CID 19590945
N-(2-bromo-4,6-difluorophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide (PubChem CID 19590945) has the molecular formula C17H17BrF2N2O3 and a molecular weight of 415.23 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19590945 |
| Molecular Formula | C17H17BrF2N2O3 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C17H17BrF2N2O3/c18-12-7-9(19)8-13(20)15(12)21-14(23)5-6-22-16(24)10-3-1-2-4-11(10)17(22)25/h7-8,10-11H,1-6H2,(H,21,23) |
| InChIKey | NWYDFVJMFLQZDI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|