C26H38N2O — CID 19590985
1-[4-(2-adamantyl)piperazin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one (PubChem CID 19590985) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 1-[4-(2-adamantyl)piperazin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one.
| Compound Name | 1-[4-(2-adamantyl)piperazin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 19590985 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 1-[4-(2-adamantyl)piperazin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one |
| SMILES | CC(C)c1ccc(CCC(=O)N2CCN(C3C4CC5CC(C4)CC3C5)CC2)cc1 |
| InChI | InChI=1S/C26H38N2O/c1-18(2)22-6-3-19(4-7-22)5-8-25(29)27-9-11-28(12-10-27)26-23-14-20-13-21(16-23)17-24(26)15-20/h3-4,6-7,18,20-21,23-24,26H,5,8-17H2,1-2H3 |
| InChIKey | SLOBXRUATQBZCZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |