C29H40N4O3S — CID 19591788
1,3-dihexyl-2-methylimidazo[4,5-b]quinoxalin-3-ium;4-methylbenzenesulfonate (PubChem CID 19591788) has the molecular formula C29H40N4O3S and a molecular weight of 524.73 g/mol. Its IUPAC name is 1,3-dihexyl-2-methylimidazo[4,5-b]quinoxalin-3-ium;4-methylbenzenesulfonate.
| Compound Name | 1,3-dihexyl-2-methylimidazo[4,5-b]quinoxalin-3-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19591788 |
| Molecular Formula | C29H40N4O3S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 1,3-dihexyl-2-methylimidazo[4,5-b]quinoxalin-3-ium;4-methylbenzenesulfonate |
| SMILES | CCCCCCn1c(C)[n+](CCCCCC)c2nc3ccccc3nc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C22H33N4.C7H8O3S/c1-4-6-8-12-16-25-18(3)26(17-13-9-7-5-2)22-21(25)23-19-14-10-11-15-20(19)24-22;1-6-2-4-7(5-3-6)11(8,9)10/h10-11,14-15H,4-9,12-13,16-17H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | SZXCUKOZPMHQIW-UHFFFAOYSA-M |
| XLogP | 6.24 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|