C30H36N2O2 — CID 19592091
N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide (PubChem CID 19592091) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 19592091 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C30H36N2O2/c1-2-20-32(27-17-18-28-26(22-27)11-8-12-29(28)33)21-7-6-19-31-30(34)25-15-13-24(14-16-25)23-9-4-3-5-10-23/h3-5,8-16,27,33H,2,6-7,17-22H2,1H3,(H,31,34) |
| InChIKey | RISZOHTXHUANFZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|