C31H38N2O2 — CID 19592121
N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide (PubChem CID 19592121) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 19592121 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1CCc2c(cccc2OC)C1 |
| InChI | InChI=1S/C31H38N2O2/c1-3-21-33(28-18-19-29-27(23-28)12-9-13-30(29)35-2)22-8-7-20-32-31(34)26-16-14-25(15-17-26)24-10-5-4-6-11-24/h4-6,9-17,28H,3,7-8,18-23H2,1-2H3,(H,32,34) |
| InChIKey | LVSUPYDDQCSHAN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|