C31H35N3O — CID 19592159
N-[4-[(5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide (PubChem CID 19592159) has the molecular formula C31H35N3O and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[4-[(5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 19592159 |
| Molecular Formula | C31H35N3O |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-[4-[(5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-phenylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1CCc2c(C#N)cccc2C1 |
| InChI | InChI=1S/C31H35N3O/c1-2-20-34(29-17-18-30-27(22-29)11-8-12-28(30)23-32)21-7-6-19-33-31(35)26-15-13-25(14-16-26)24-9-4-3-5-10-24/h3-5,8-16,29H,2,6-7,17-22H2,1H3,(H,33,35) |
| InChIKey | ZQAMNGCYKZHATK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|