C33H33Cl2F6N3O2 — CID 19592200
N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-formylamino]-3-(3,4-dichlorophenyl)butyl]-4-phenylpiperidin-4-yl]acetamide (PubChem CID 19592200) has the molecular formula C33H33Cl2F6N3O2 and a molecular weight of 688.54 g/mol. Its IUPAC name is N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-formylamino]-3-(3,4-dichlorophenyl)butyl]-4-phenylpiperidin-4-yl]acetamide.
| Compound Name | N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-formylamino]-3-(3,4-dichlorophenyl)butyl]-4-phenylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 19592200 |
| Molecular Formula | C33H33Cl2F6N3O2 |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 687.19 |
| IUPAC Name | N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-formylamino]-3-(3,4-dichlorophenyl)butyl]-4-phenylpiperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1(c2ccccc2)CCN(CCC(CN(C=O)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C33H33Cl2F6N3O2/c1-22(46)42-31(26-5-3-2-4-6-26)10-13-43(14-11-31)12-9-25(24-7-8-29(34)30(35)17-24)20-44(21-45)19-23-15-27(32(36,37)38)18-28(16-23)33(39,40)41/h2-8,15-18,21,25H,9-14,19-20H2,1H3,(H,42,46) |
| InChIKey | FFTPZPUCBXNNOZ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|