C26H50INO3S — CID 19593267
butane-1-sulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecylpiperidin-1-ium (PubChem CID 19593267) has the molecular formula C26H50INO3S and a molecular weight of 583.66 g/mol. Its IUPAC name is butane-1-sulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecylpiperidin-1-ium.
| Compound Name | butane-1-sulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecylpiperidin-1-ium |
|---|---|
| PubChem CID | 19593267 |
| Molecular Formula | C26H50INO3S |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | butane-1-sulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecylpiperidin-1-ium |
| SMILES | CCCCCCCCCCCCCC[N+]1(CC#CI)CCCCC1.CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H41IN.C4H10O3S/c1-2-3-4-5-6-7-8-9-10-11-12-14-19-24(22-17-18-23)20-15-13-16-21-24;1-2-3-4-8(5,6)7/h2-16,19-22H2,1H3;2-4H2,1H3,(H,5,6,7)/q+1;/p-1 |
| InChIKey | YBQYBPGOBHKCDA-UHFFFAOYSA-M |
| XLogP | 7.42 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|