About 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one
5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one (PubChem CID 19594647) has the molecular formula C22H27NO4
and a molecular weight of 369.46 g/mol. Its IUPAC name is 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one.
Molecular Properties
| Compound Name | 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one |
| PubChem CID | 19594647 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one |
| SMILES | CCN(CC)CCCOc1cccc2c1-c1c(OC)cc(OC)cc1C2=O |
| InChI | InChI=1S/C22H27NO4/c1-5-23(6-2)11-8-12-27-18-10-7-9-16-20(18)21-17(22(16)24)13-15(25-3)14-19(21)26-4/h7,9-10,13-14H,5-6,8,11-12H2,1-4H3 |
| InChIKey | IOWMKJVFVAYNAD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one?
The IUPAC name of 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one (CID 19594647) is 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one.
What is the SMILES notation for 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one?
The canonical SMILES for 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one is CCN(CC)CCCOc1cccc2c1-c1c(OC)cc(OC)cc1C2=O.
What is the InChIKey of 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one?
The InChIKey is IOWMKJVFVAYNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO4/c1-5-23(6-2)11-8-12-27-18-10-7-9-16-20(18)21-17(22(16)24)13-15(25-3)14-19(21)26-4/h7,9-10,13-14H,5-6,8,11-12H2,1-4H3.
What are the key properties of 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one?
5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one has a molecular weight of 369.46 g/mol, XLogP of 4.03, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(diethylamino)propoxy]-2,4-dimethoxyfluoren-9-one is sourced from PubChem (CID 19594647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).