C27H35NO4 — CID 19594648
5-(1-piperidin-3-ylpropoxy)-2,4-dipropoxyfluoren-9-one (PubChem CID 19594648) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is 5-(1-piperidin-3-ylpropoxy)-2,4-dipropoxyfluoren-9-one.
| Compound Name | 5-(1-piperidin-3-ylpropoxy)-2,4-dipropoxyfluoren-9-one |
|---|---|
| PubChem CID | 19594648 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 5-(1-piperidin-3-ylpropoxy)-2,4-dipropoxyfluoren-9-one |
| SMILES | CCCOc1cc(OCCC)c2c(c1)C(=O)c1cccc(OC(CC)C3CCCNC3)c1-2 |
| InChI | InChI=1S/C27H35NO4/c1-4-13-30-19-15-21-26(24(16-19)31-14-5-2)25-20(27(21)29)10-7-11-23(25)32-22(6-3)18-9-8-12-28-17-18/h7,10-11,15-16,18,22,28H,4-6,8-9,12-14,17H2,1-3H3 |
| InChIKey | ADLYRSVUZSGJBH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |