C24H29NO4 — CID 19594650
4-methoxy-5-(1-piperidin-2-ylethoxy)-2-propoxyfluoren-9-one (PubChem CID 19594650) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-methoxy-5-(1-piperidin-2-ylethoxy)-2-propoxyfluoren-9-one.
| Compound Name | 4-methoxy-5-(1-piperidin-2-ylethoxy)-2-propoxyfluoren-9-one |
|---|---|
| PubChem CID | 19594650 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-methoxy-5-(1-piperidin-2-ylethoxy)-2-propoxyfluoren-9-one |
| SMILES | CCCOc1cc(OC)c2c(c1)C(=O)c1cccc(OC(C)C3CCCCN3)c1-2 |
| InChI | InChI=1S/C24H29NO4/c1-4-12-28-16-13-18-23(21(14-16)27-3)22-17(24(18)26)8-7-10-20(22)29-15(2)19-9-5-6-11-25-19/h7-8,10,13-15,19,25H,4-6,9,11-12H2,1-3H3 |
| InChIKey | HSCGRXFARGERCQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |