About 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one
1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one (PubChem CID 19594671) has the molecular formula C29H39N3O4
and a molecular weight of 493.65 g/mol. Its IUPAC name is 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one.
Molecular Properties
| Compound Name | 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one |
| PubChem CID | 19594671 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one |
| SMILES | CCCCOc1cc(OCCC2CCCN2)c(N)c2c1-c1c(OCCC3CCCN3)cccc1C2=O |
| InChI | InChI=1S/C29H39N3O4/c1-2-3-15-34-23-18-24(36-17-12-20-8-6-14-32-20)28(30)27-26(23)25-21(29(27)33)9-4-10-22(25)35-16-11-19-7-5-13-31-19/h4,9-10,18-20,31-32H,2-3,5-8,11-17,30H2,1H3 |
| InChIKey | YJFOMRMAACORHX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
The IUPAC name of 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one (CID 19594671) is 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one.
What is the SMILES notation for 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
The canonical SMILES for 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one is CCCCOc1cc(OCCC2CCCN2)c(N)c2c1-c1c(OCCC3CCCN3)cccc1C2=O.
What is the InChIKey of 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
The InChIKey is YJFOMRMAACORHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H39N3O4/c1-2-3-15-34-23-18-24(36-17-12-20-8-6-14-32-20)28(30)27-26(23)25-21(29(27)33)9-4-10-22(25)35-16-11-19-7-5-13-31-19/h4,9-10,18-20,31-32H,2-3,5-8,11-17,30H2,1H3.
What are the key properties of 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one has a molecular weight of 493.65 g/mol, XLogP of 4.70, 12 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one is sourced from PubChem (CID 19594671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).