C24H32N2O3 — CID 19595422
1-(methylaminomethyl)-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 19595422) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(methylaminomethyl)-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | 1-(methylaminomethyl)-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 19595422 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-(methylaminomethyl)-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CNCC1OC(C2CCN(CCc3ccccc3)CC2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C24H32N2O3/c1-25-16-23-19-7-8-21(27)24(28)20(19)15-22(29-23)18-10-13-26(14-11-18)12-9-17-5-3-2-4-6-17/h2-8,18,22-23,25,27-28H,9-16H2,1H3 |
| InChIKey | IRYUCMOMOGQFLE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|