About N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide
N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide (PubChem CID 19595460) has the molecular formula C16H16N2O3
and a molecular weight of 284.32 g/mol. Its IUPAC name is N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide.
Molecular Properties
| Compound Name | N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide |
| PubChem CID | 19595460 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide |
| SMILES | COc1cccc(/C=C(/NC=O)c2ccncc2)c1OC |
| InChI | InChI=1S/C16H16N2O3/c1-20-15-5-3-4-13(16(15)21-2)10-14(18-11-19)12-6-8-17-9-7-12/h3-11H,1-2H3,(H,18,19)/b14-10+ |
| InChIKey | YAMKOHXPKDJNDE-GXDHUFHOSA-N |
| XLogP | 2.34 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide?
The IUPAC name of N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide (CID 19595460) is N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide.
What is the SMILES notation for N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide?
The canonical SMILES for N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide is COc1cccc(/C=C(/NC=O)c2ccncc2)c1OC.
What is the InChIKey of N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide?
The InChIKey is YAMKOHXPKDJNDE-GXDHUFHOSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-20-15-5-3-4-13(16(15)21-2)10-14(18-11-19)12-6-8-17-9-7-12/h3-11H,1-2H3,(H,18,19)/b14-10+.
What are the key properties of N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide?
N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide has a molecular weight of 284.32 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-(2,3-dimethoxyphenyl)-1-pyridin-4-ylethenyl]formamide is sourced from PubChem (CID 19595460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).