C20H28O — CID 19595639
2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]acetaldehyde (PubChem CID 19595639) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]acetaldehyde.
| Compound Name | 2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]acetaldehyde |
|---|---|
| PubChem CID | 19595639 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]acetaldehyde |
| SMILES | Cc1cc2c(cc1C1(CC=O)CC1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C20H28O/c1-14-12-16-17(19(4,5)7-6-18(16,2)3)13-15(14)20(8-9-20)10-11-21/h11-13H,6-10H2,1-5H3 |
| InChIKey | CVZXBEXIAWIPLY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|