About 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide
8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide (PubChem CID 19595721) has the molecular formula C15H14O2P+
and a molecular weight of 257.25 g/mol. Its IUPAC name is 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide.
Molecular Properties
| Compound Name | 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide |
| PubChem CID | 19595721 |
| Molecular Formula | C15H14O2P+ |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide |
| SMILES | CC(C)c1ccc2c3ccccc3o[p+](=O)c2c1 |
| InChI | InChI=1S/C15H14O2P/c1-10(2)11-7-8-13-12-5-3-4-6-14(12)17-18(16)15(13)9-11/h3-10H,1-2H3/q+1 |
| InChIKey | FDFOKULCORFCLK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide?
The IUPAC name of 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide (CID 19595721) is 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide.
What is the SMILES notation for 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide?
The canonical SMILES for 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide is CC(C)c1ccc2c3ccccc3o[p+](=O)c2c1.
What is the InChIKey of 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide?
The InChIKey is FDFOKULCORFCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2P/c1-10(2)11-7-8-13-12-5-3-4-6-14(12)17-18(16)15(13)9-11/h3-10H,1-2H3/q+1.
What are the key properties of 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide?
8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide has a molecular weight of 257.25 g/mol, XLogP of 5.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-ylbenzo[c][1,2]benzoxaphosphinin-6-ium 6-oxide is sourced from PubChem (CID 19595721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).