About 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride
2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride (PubChem CID 19596627) has the molecular formula C11H12Cl2N2O2
and a molecular weight of 275.13 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride |
| PubChem CID | 19596627 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride |
| SMILES | Cl.NCCOc1cc(-c2ccccc2Cl)on1 |
| InChI | InChI=1S/C11H11ClN2O2.ClH/c12-9-4-2-1-3-8(9)10-7-11(14-16-10)15-6-5-13;/h1-4,7H,5-6,13H2;1H |
| InChIKey | BGKPSDMFJCTOFW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride?
The IUPAC name of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride (CID 19596627) is 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride.
What is the SMILES notation for 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride?
The canonical SMILES for 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride is Cl.NCCOc1cc(-c2ccccc2Cl)on1.
What is the InChIKey of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride?
The InChIKey is BGKPSDMFJCTOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O2.ClH/c12-9-4-2-1-3-8(9)10-7-11(14-16-10)15-6-5-13;/h1-4,7H,5-6,13H2;1H.
What are the key properties of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride?
2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride has a molecular weight of 275.13 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine;hydrochloride is sourced from PubChem (CID 19596627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).