About 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine
2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine (PubChem CID 19596628) has the molecular formula C11H11ClN2O2
and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine.
Molecular Properties
| Compound Name | 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine |
| PubChem CID | 19596628 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine |
| SMILES | NCCOc1cc(-c2ccccc2Cl)on1 |
| InChI | InChI=1S/C11H11ClN2O2/c12-9-4-2-1-3-8(9)10-7-11(14-16-10)15-6-5-13/h1-4,7H,5-6,13H2 |
| InChIKey | YLKFTRGXCFAHPB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine?
The IUPAC name of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine (CID 19596628) is 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine.
What is the SMILES notation for 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine?
The canonical SMILES for 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine is NCCOc1cc(-c2ccccc2Cl)on1.
What is the InChIKey of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine?
The InChIKey is YLKFTRGXCFAHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O2/c12-9-4-2-1-3-8(9)10-7-11(14-16-10)15-6-5-13/h1-4,7H,5-6,13H2.
What are the key properties of 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine?
2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine has a molecular weight of 238.67 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethanamine is sourced from PubChem (CID 19596628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).