About 10H-phenothiazine-1,2-diol
10H-phenothiazine-1,2-diol (PubChem CID 19596784) has the molecular formula C12H9NO2S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 10H-phenothiazine-1,2-diol.
Molecular Properties
| Compound Name | 10H-phenothiazine-1,2-diol |
| PubChem CID | 19596784 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 10H-phenothiazine-1,2-diol |
| SMILES | Oc1ccc2c(c1O)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NO2S/c14-8-5-6-10-11(12(8)15)13-7-3-1-2-4-9(7)16-10/h1-6,13-15H |
| InChIKey | QXHKTCUAPTVNQV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenothiazine-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenothiazine-1,2-diol?
The IUPAC name of 10H-phenothiazine-1,2-diol (CID 19596784) is 10H-phenothiazine-1,2-diol.
What is the SMILES notation for 10H-phenothiazine-1,2-diol?
The canonical SMILES for 10H-phenothiazine-1,2-diol is Oc1ccc2c(c1O)Nc1ccccc1S2.
What is the InChIKey of 10H-phenothiazine-1,2-diol?
The InChIKey is QXHKTCUAPTVNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2S/c14-8-5-6-10-11(12(8)15)13-7-3-1-2-4-9(7)16-10/h1-6,13-15H.
What are the key properties of 10H-phenothiazine-1,2-diol?
10H-phenothiazine-1,2-diol has a molecular weight of 231.28 g/mol, XLogP of 3.31, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenothiazine-1,2-diol is sourced from PubChem (CID 19596784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).