C8H8Cl5NO3 — CID 19596815
N,N-dihydroxyethanamine;2,3,4,5,6-pentachlorophenol (PubChem CID 19596815) has the molecular formula C8H8Cl5NO3 and a molecular weight of 343.42 g/mol. Its IUPAC name is N,N-dihydroxyethanamine;2,3,4,5,6-pentachlorophenol.
| Compound Name | N,N-dihydroxyethanamine;2,3,4,5,6-pentachlorophenol |
|---|---|
| PubChem CID | 19596815 |
| Molecular Formula | C8H8Cl5NO3 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 340.89 |
| IUPAC Name | N,N-dihydroxyethanamine;2,3,4,5,6-pentachlorophenol |
| SMILES | CCN(O)O.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O.C2H7NO2/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-2-3(4)5/h12H;4-5H,2H2,1H3 |
| InChIKey | CNGXWTPVPCJTFS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|