C7H14N6O2 — CID 19596820
2-N,2-N-bis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 19596820) has the molecular formula C7H14N6O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-N,2-N-bis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-bis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19596820 |
| Molecular Formula | C7H14N6O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-N,2-N-bis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCN(COC)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H14N6O2/c1-14-3-13(4-15-2)7-11-5(8)10-6(9)12-7/h3-4H2,1-2H3,(H4,8,9,10,11,12) |
| InChIKey | ZZQSSGSSJLWADI-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|