C11H22N6O4 — CID 19596821
2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 19596821) has the molecular formula C11H22N6O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19596821 |
| Molecular Formula | C11H22N6O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCN(COC)c1nc(N)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C11H22N6O4/c1-18-5-16(6-19-2)10-13-9(12)14-11(15-10)17(7-20-3)8-21-4/h5-8H2,1-4H3,(H2,12,13,14,15) |
| InChIKey | GDXYMSLKTXSGBS-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|