About thiolane-3,4-diol
thiolane-3,4-diol (PubChem CID 19596996) has the molecular formula C4H8O2S
and a molecular weight of 120.17 g/mol. Its IUPAC name is thiolane-3,4-diol.
Molecular Properties
| Compound Name | thiolane-3,4-diol |
| PubChem CID | 19596996 |
| Molecular Formula | C4H8O2S |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | thiolane-3,4-diol |
| SMILES | OC1CSCC1O |
| InChI | InChI=1S/C4H8O2S/c5-3-1-7-2-4(3)6/h3-6H,1-2H2 |
| InChIKey | WONPWMKTZAPWSP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiolane-3,4-diol?
The IUPAC name of thiolane-3,4-diol (CID 19596996) is thiolane-3,4-diol.
What is the SMILES notation for thiolane-3,4-diol?
The canonical SMILES for thiolane-3,4-diol is OC1CSCC1O.
What is the InChIKey of thiolane-3,4-diol?
The InChIKey is WONPWMKTZAPWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S/c5-3-1-7-2-4(3)6/h3-6H,1-2H2.
What are the key properties of thiolane-3,4-diol?
thiolane-3,4-diol has a molecular weight of 120.17 g/mol, XLogP of -0.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiolane-3,4-diol is sourced from PubChem (CID 19596996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).